Fmoc-D-4-Cyanophenylalanine
- Product NameFmoc-D-4-Cyanophenylalanine
- CAS205526-34-7
- MFC25H20N2O4
- MW412.44
- EINECS
- MOL File205526-34-7.mol
Chemical Properties
| Melting point | 188.1 °C |
| Boiling point | 531.88°C (rough estimate) |
| Density | 1.2691 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.62±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | JOPKKUTWCGYCDA-HSZRJFAPSA-N |
| SMILES | OC(=O)[C@@H](Cc1ccc(cc1)C#N)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 205526-34-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
