N,N-Diphenylacetamide
- Product NameN,N-Diphenylacetamide
- CAS519-87-9
- MFC14H13NO
- MW211.26
- EINECS208-277-1
- MOL File519-87-9.mol
Chemical Properties
| Melting point | 100-103 °C(lit.) |
| Boiling point | 130 °C0.02 mm Hg(lit.) |
| Density | 1.0694 (rough estimate) |
| refractive index | 1.5780 (estimate) |
| storage temp. | Store below +30°C. |
| pka | -3.21±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Merck | 14,3315 |
| InChI | 1S/C14H13NO/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | DKLYDESVXZKCFI-UHFFFAOYSA-N |
| SMILES | N(c2ccccc2)(c1ccccc1)C(=O)C |
| CAS DataBase Reference | 519-87-9(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, N,N-diphenyl- (519-87-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | AB8133000 |
| TSCA | TSCA listed |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |