6-Amino-3,4-dihydro-1(2H)-naphthalenone
- Product Name6-Amino-3,4-dihydro-1(2H)-naphthalenone
- CAS3470-53-9
- MFC10H11NO
- MW161.2
- EINECS
- MOL File3470-53-9.mol
Chemical Properties
| Melting point | 130 °C |
| Boiling point | 359.4±31.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.20±0.20(Predicted) |
| color | Light yellow to Brown |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H11NO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3,11H2 |
| InChIKey | BEVVUJBVEXJGKM-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(N)C=C2)CCC1 |
| CAS DataBase Reference | 3470-53-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T;Xn,Xi,Xn,T |
| Risk Statements | 20/21/22-25 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2921450090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
