(4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester
- Product Name(4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester
- CAS90101-20-5
- MFC11H16N2O2
- MW208.26
- EINECS
- MOL File90101-20-5.mol
Chemical Properties
| Melting point | 118-119℃ |
| Boiling point | 274.2±28.0 °C(Predicted) |
| Density | 1.108±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 12.56±0.70(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C11H16N2O2/c1-8-5-6-12-9(7-8)13-10(14)15-11(2,3)4/h5-7H,1-4H3,(H,12,13,14) |
| InChIKey | SABMAMDNSRZJBK-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1=NC=CC(C)=C1 |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |