2-Fluoro-6-hydroxybenzoic acid
- Product Name2-Fluoro-6-hydroxybenzoic acid
- CAS67531-86-6
- MFC7H5FO3
- MW156.11
- EINECS627-357-0
- MOL File67531-86-6.mol
Chemical Properties
| Melting point | 159-163 °C (lit.) |
| Boiling point | 291.2±25.0 °C(Predicted) |
| Density | 1.492±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.68±0.25(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 7111497 |
| InChI | InChI=1S/C7H5FO3/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | BCEKGWWLVKXZKK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(O)C=CC=C1F |
| CAS DataBase Reference | 67531-86-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29181990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
