2,4,5-Trifluorobenzaldehyde
- Product Name2,4,5-Trifluorobenzaldehyde
- CAS165047-24-5
- MFC7H3F3O
- MW160.09
- EINECS605-382-8
- MOL File165047-24-5.mol
Chemical Properties
| Boiling point | 168 °C (lit.) |
| Density | 1.408 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 137 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.408 |
| color | Clear colorless to light yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| BRN | 8479631 |
| InChI | InChI=1S/C7H3F3O/c8-5-2-7(10)6(9)1-4(5)3-11/h1-3H |
| InChIKey | CYIFJRXFYSUBFW-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 165047-24-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29130000 |
