2,3,4,6-Tetra-O-acetyl-alpha-D-glucopyranosyl bromide
- Product Name2,3,4,6-Tetra-O-acetyl-alpha-D-glucopyranosyl bromide
- CAS572-09-8
- MFC14H19BrO9
- MW411.2
- EINECS209-339-0
- MOL File572-09-8.mol
Chemical Properties
| Melting point | 86-89 °C |
| Boiling point | 0.125-30 °C(Press: 0.0005 Torr) |
| alpha | 194.5 º (c=2,chloroform) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Acetontrile (Very Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to beige |
| biological source | synthetic (organic) |
| optical activity | [α]25/D 188 to 202 °, c =1 in chloroform |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| Merck | 14,60 |
| BRN | 96669 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H19BrO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | CYAYKKUWALRRPA-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | - |
| F | 8-10-21 |
| HS Code | 29329985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
