Methyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside
- Product NameMethyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside
- CAS53008-65-4
- MFC28H32O6
- MW464.55
- EINECS
- MOL File53008-65-4.mol
Chemical Properties
| Melting point | 67 °C |
| Boiling point | 593.0±50.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| refractive index | 24.5 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | powder to crystal |
| pka | 14.48±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]/D 23.0±2.0°, c = 1 in chloroform |
| BRN | 1442065 |
| InChIKey | MOKYEUQDXDKNDX-FAGPOLGCNA-N |
| SMILES | [C@H]1(OCC2C=CC=CC=2)[C@@H](OC)O[C@H](CO)[C@@H](OCC2=CC=CC=C2)[C@@H]1OCC1C=CC=CC=1 |&1:0,9,13,16,25,r| |
Safety Information
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
