3-Dimethylaminopropiophenone hydrochloride
- Product Name3-Dimethylaminopropiophenone hydrochloride
- CAS879-72-1
- MFC11H16ClNO
- MW213.7
- EINECS212-909-1
- MOL File879-72-1.mol
Chemical Properties
| Melting point | 150-155 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| BRN | 3568398 |
| InChI | InChI=1S/C11H15NO.ClH/c1-12(2)9-8-11(13)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H |
| InChIKey | DKNDBIIKSJWQFL-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)CCN(C)C.[H]Cl |
| CAS DataBase Reference | 879-72-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanone, 3-(dimethylamino)-1-phenyl-, hydrochloride (879-72-1) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UH0600000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29223900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |