3-Formyl-6-isopropylchromone
- Product Name3-Formyl-6-isopropylchromone
- CAS49619-58-1
- MFC13H12O3
- MW216.23
- EINECS624-175-3
- MOL File49619-58-1.mol
Chemical Properties
| Melting point | 98-100 °C(lit.) |
| Boiling point | 339.8±42.0 °C(Predicted) |
| Density | 1.17 g/cm3 |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C13H12O3/c1-8(2)9-3-4-12-11(5-9)13(15)10(6-14)7-16-12/h3-8H,1-2H3 |
| InChIKey | FRRYMYQANNFABF-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=C(C(C)C)C=C2C(=O)C=1C=O |
| CAS DataBase Reference | 49619-58-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2932.99.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |