| Melting point |
209-211°C |
| Boiling point |
242.0±33.0 °C(Predicted) |
| Density |
1.275±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
Methanol (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
2.35±0.20(Predicted) |
| color |
White to Off-White |
| optical activity |
Consistent with structure |
| Stability |
Temperature Sensitive - Do Not Heat Above 55°C |
| InChI |
InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1 |
| InChIKey |
IADUEWIQBXOCDZ-GSVOUGTGSA-N |
| SMILES |
N1CC[C@@H]1C(O)=O |
| CAS DataBase Reference |
7729-30-8(CAS DataBase Reference) |
