Fmoc-L-Azetidine-3-carboxylic acid
- Product NameFmoc-L-Azetidine-3-carboxylic acid
- CAS193693-64-0
- MFC19H17NO4
- MW323.34
- EINECS
- MOL File193693-64-0.mol
Chemical Properties
| Melting point | 174 °C |
| Boiling point | 540-545℃ |
| Density | 1.368 |
| Flash point | 282°(540°F) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 4.16±0.20(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | 1S/C19H17NO4/c21-18(22)12-9-20(10-12)19(23)24-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17H,9-11H2,(H,21,22) |
| InChIKey | QDEJCUHGSHSYQH-UHFFFAOYSA-N |
| SMILES | OC(=O)C1CN(C1)C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 193693-64-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37-60 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |