2-(Bromomethyl)acrylic acid
- Product Name2-(Bromomethyl)acrylic acid
- CAS72707-66-5
- MFC4H5BrO2
- MW164.99
- EINECS276-774-0
- MOL File72707-66-5.mol
Chemical Properties
| Melting point | 70-73 °C (lit.) |
| Boiling point | 268.8±23.0 °C(Predicted) |
| Density | 1.696±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.45±0.11(Predicted) |
| color | White to Almost white |
| BRN | 2426204 |
| InChI | InChI=1S/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7) |
| InChIKey | NOOYFQLPKUQDNE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(CBr)=C |
| CAS DataBase Reference | 72707-66-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2916.19.3000 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
