Ethyl 2-(bromomethyl)acrylate
- Product NameEthyl 2-(bromomethyl)acrylate
- CAS17435-72-2
- MFC6H9BrO2
- MW193.04
- EINECS628-033-1
- MOL File17435-72-2.mol
Chemical Properties
| Melting point | 134-136℃ |
| Boiling point | 38 °C/0.8 mmHg (lit.) |
| Density | 1.398 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 178 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless to pale yellow |
| BRN | 970108 |
| InChI | InChI=1S/C6H9BrO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3 |
| InChIKey | MTCMFVTVXAOHNQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(CBr)=C |
| CAS DataBase Reference | 17435-72-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1 / PGII |
| WGK Germany | 3 |
| F | 10-19-23 |
| HazardClass | 6.1 |
| HS Code | 29161900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |