4,4',4''-Trimethyltriphenylamine
- Product Name4,4',4''-Trimethyltriphenylamine
- CAS1159-53-1
- MFC21H21N
- MW287.4
- EINECS214-595-1
- MOL File1159-53-1.mol
Chemical Properties
| Melting point | 114-118°C |
| Boiling point | 170 °C / 0.1mmHg |
| Density | 1.10 g/cm3 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in chloroform and tetrahydrofuran (THF). |
| pka | -1.76±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C21H21N/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | YXYUIABODWXVIK-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(C)C=C2)C2=CC=C(C)C=C2)=CC=C(C)C=C1 |
| CAS DataBase Reference | 1159-53-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-methyl-N,N-bis(4-methylphenyl)- (1159-53-1) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214990 |
