3,5-Bis(trifluoromethyl)benzyl chloride
- Product Name3,5-Bis(trifluoromethyl)benzyl chloride
- CAS75462-59-8
- MFC9H5ClF6
- MW262.58
- EINECS278-216-1
- MOL File75462-59-8.mol
Chemical Properties
| Melting point | 29-32 °C(lit.) |
| Boiling point | 46°C 3mm |
| Density | 1.4425 (estimate) |
| Flash point | 161 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to lump |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| BRN | 656502 |
| InChI | InChI=1S/C9H5ClF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 |
| InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N |
| SMILES | C(Cl)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 75462-59-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl chloride(75462-59-8) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
