2,6-Dimethylnaphthalene
- Product Name2,6-Dimethylnaphthalene
- CAS581-42-0
- MFC12H12
- MW156.22
- EINECS209-464-0
- MOL File581-42-0.mol
Chemical Properties
| Melting point | 106-110 °C (lit.) |
| Boiling point | 262 °C (lit.) |
| Density | 1.01 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 2mg/L(25 ºC) |
| BRN | 1903544 |
| Henry's Law Constant | 7.8×10-3 mol/(m3Pa) at 25℃, Mackay et al. (2006) |
| InChI | InChI=1S/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
| InChIKey | YGYNBBAUIYTWBF-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(C)C=C2)=CC=C1C |
| LogP | 4.310 |
| CAS DataBase Reference | 581-42-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Dimethylnaphthalene (581-42-0) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 22-24/25-61-60 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2902.90.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
