Methyl 4-aminobutyrate hydrochloride
- Product NameMethyl 4-aminobutyrate hydrochloride
- CAS13031-60-2
- MFC5H12ClNO2
- MW153.61
- EINECS629-526-4
- MOL File13031-60-2.mol
Chemical Properties
| Melting point | 120-125 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3558996 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H11NO2.ClH/c1-8-5(7)3-2-4-6;/h2-4,6H2,1H3;1H |
| InChIKey | WPGPRLVPWACBHW-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CCCN.Cl |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | ES7065000 |
| F | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |