Ethyl diazoacetoacetate
- Product NameEthyl diazoacetoacetate
- CAS2009-97-4
- MFC6H8N2O3
- MW156.14
- EINECS
- MOL File2009-97-4.mol
Chemical Properties
| Boiling point | 102-103 °C(Press: 12 Torr) |
| Density | 1.131 g/mL at 25 °C (lit.) |
| vapor pressure | 0.36 psi ( 20 °C) |
| refractive index | n |
| Flash point | 185 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C6H8N2O3/c1-3-11-6(10)5(8-7)4(2)9/h3H2,1-2H3 |
| InChIKey | JWTPSIXYXYNAOU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(C)=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29270000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Self-react. C Skin Irrit. 2 STOT SE 3 |