Chemical Properties
| Boiling point | 377.9±11.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | -20°C, protect from light, stored under nitrogen |
| solubility | DMSO : 100 mg/mL (525.65 mM; Need ultrasonic) |
| form | Oil |
| color | Colorless to light yellow |
| Stability | Light Sensitive |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | IQVQXVFMNOFTMU-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(CCC=C2)C(=CCCC)O1 |
| LogP | 1.710 (est) |
Safety Information
| Risk Statements | 22/23 |
| Safety Statements | 24/25 |
| RIDADR | 2810 |
| WGK Germany | WGK 3 |
| HS Code | 29322090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
