3,3'-Diethylthiacarbocyanine iodide
- Product Name3,3'-Diethylthiacarbocyanine iodide
- CAS905-97-5
- MFC21H21IN2S2
- MW492.44
- EINECS
- MOL File905-97-5.mol
Chemical Properties
| Melting point | 268-270 °C (dec.) (lit.) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | DMSO: soluble |
| form | powder to crystal |
| color | Amber to Brown to Dark green |
| Sensitive | Light Sensitive |
| λmax | 557nm(MeOH)(lit.) |
| ex/em | λex 559, 295 nm; λem 625, 571 nm in EtOH |
| BRN | 4117818 |
| InChI | 1S/C21H21N2S2.HI/c1-3-22-16-10-5-7-12-18(16)24-20(22)14-9-15-21-23(4-2)17-11-6-8-13-19(17)25-21;/h5-15H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VZBILKJHDPEENF-UHFFFAOYSA-M |
| SMILES | [I-].CCN1\C(Sc2ccccc12)=C\C=C\c3sc4ccccc4[n+]3CC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DL7061500 |
| F | 8-10 |
| HS Code | 2934.20.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
