2,2'-Iminodibenzoic acid
- Product Name2,2'-Iminodibenzoic acid
- CAS579-92-0
- MFC14H11NO4
- MW257.24
- EINECS200-258-5
- MOL File579-92-0.mol
Chemical Properties
| Melting point | 298 °C (dec.)(lit.) |
| Boiling point | 400.49°C (rough estimate) |
| Density | 1.2471 (rough estimate) |
| refractive index | 1.5780 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.36±0.36(Predicted) |
| Appearance | Light yellow to khaki Solid |
| Merck | 13,3350 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H11NO4/c16-13(17)9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(18)19/h1-8,15H,(H,16,17)(H,18,19) |
| InChIKey | ZFRNOTZQUGWMQN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1Nc2ccccc2C(O)=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DH2960000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
