2-Chloro-4-(trifluoromethyl)phenylboronic acid
- Product Name2-Chloro-4-(trifluoromethyl)phenylboronic acid
- CAS313545-41-4
- MFC7H5BClF3O2
- MW224.37
- EINECS
- MOL File313545-41-4.mol
Chemical Properties
| Melting point | 70-72 |
| Boiling point | 287.6±50.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.97±0.58(Predicted) |
| color | White to Almost white |
| InChI | 1S/C7H5BClF3O2/c9-4-1-2-6(8(13)14)5(3-4)7(10,11)12/h1-3,13-14H |
| InChIKey | YAPBOBGBYQQYHX-UHFFFAOYSA-N |
| SMILES | OB(C1=CC=C(Cl)C=C1C(F)(F)F)O |
| CAS DataBase Reference | 313545-41-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36-36/37/38 |
| Safety Statements | 26-37 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
