4,4'-Methylenebis(2-methylcyclohexylamine)
- Product Name4,4'-Methylenebis(2-methylcyclohexylamine)
- CAS6864-37-5
- MFC15H30N2
- MW238.41
- EINECS229-962-1
- MOL File6864-37-5.mol
Chemical Properties
| Melting point | -7°C |
| Boiling point | 93-100 °C(lit.) |
| Density | 0.94 g/mL at 25 °C(lit.) |
| vapor pressure | 0.08Pa at 20℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 3.6g/l |
| pka | 11.03±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| PH | 11 (3.6g/l, H2O, 20℃) |
| explosive limit | 0.5-2.8%(V) |
| Water Solubility | 2.01g/L at 20℃ |
| InChI | 1S/C15H30N2/c1-10-7-12(3-5-14(10)16)9-13-4-6-15(17)11(2)8-13/h10-15H,3-9,16-17H2,1-2H3 |
| InChIKey | IGSBHTZEJMPDSZ-UHFFFAOYSA-N |
| SMILES | CC1CC(CCC1N)CC2CCC(N)C(C)C2 |
| LogP | 2.3 at 23℃ |
Safety Information
| Hazard Codes | T,C,N |
| Risk Statements | 22-23/24-35-51/53 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 2927 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29213000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Skin Corr. 1A |
| Toxicity | LC50 ihl-rat: 420 mg/m3/4H NTIS** OTS0539620-1 |
