| Melting point |
88-90 °C |
| Boiling point |
394.44°C (rough estimate) |
| Density |
1.1711 (rough estimate) |
| refractive index |
1.5290 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble in DMSO (>100 mM), and methanol (>25 mM). |
| form |
Light yellow powder. |
| Appearance |
Light yellow to yellow Solid |
| BRN |
2218433 |
| InChI |
1S/C12H17N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11H,7,13H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey |
AXZJHDNQDSVIDR-NSHDSACASA-N |
| SMILES |
CC(C)C[C@H](N)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference |
4178-93-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Pentanamide, 2-amino-4-methyl-N-(4-nitrophenyl)-, (2S)- (4178-93-2) |
