Nalpha-Fmoc-L-tyrosine
- Product NameNalpha-Fmoc-L-tyrosine
- CAS92954-90-0
- MFC24H21NO5
- MW403.43
- EINECS
- MOL File92954-90-0.mol
Chemical Properties
| Melting point | 182-187 °C |
| alpha | -22 º (c=1%, DMF) |
| Boiling point | 672.6±55.0 °C(Predicted) |
| Density | 1.336±0.06 g/cm3(Predicted) |
| refractive index | -22.0 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.95±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 22±2°, c = 1% in DMF |
| BRN | 3573123 |
| Major Application | peptide synthesis |
| InChI | 1S/C24H21NO5/c26-16-11-9-15(10-12-16)13-22(23(27)28)25-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,26H,13-14H2,(H,25,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | SWZCTMTWRHEBIN-QFIPXVFZSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 92954-90-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 13 - Non Combustible Solids |
