3-(4-Hydroxy-3-methoxyphenyl)propionic acid
- Product Name3-(4-Hydroxy-3-methoxyphenyl)propionic acid
- CAS1135-23-5
- MFC10H12O4
- MW196.2
- EINECS214-489-5
- MOL File1135-23-5.mol
Chemical Properties
| Melting point | 87-93 °C |
| Boiling point | 120-130 °C(Press: 0.5 Torr) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| pka | 4.73±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2110370 |
| InChI | InChI=1S/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13) |
| InChIKey | BOLQJTPHPSDZHR-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=C(O)C(OC)=C1 |
| LogP | 0.810 (est) |
| CAS DataBase Reference | 1135-23-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |