Orotic acid monohydrate
- Product NameOrotic acid monohydrate
- CAS50887-69-9
- MFC5H6N2O5
- MW174.11
- EINECS610-580-2
- MOL File50887-69-9.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Soluble in water (1.7 mg/ml), and ammonium hydroxide. Insoluble in chloroform. |
| Merck | 14,6876 |
| BRN | 383901 |
| InChI | InChI=1S/C5H4N2O4.H2O/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);1H2 |
| InChIKey | YXUZGLGRBBHYFZ-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)NC(NC(=O)C=1)=O.O |
| CAS DataBase Reference | 50887-69-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | RM3180000 |
| TSCA | Yes |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |