4-Fluoro-3-(trifluoromethyl)phenol
- Product Name4-Fluoro-3-(trifluoromethyl)phenol
- CAS61721-07-1
- MFC7H4F4O
- MW180.1
- EINECS432-560-0
- MOL File61721-07-1.mol
Chemical Properties
| Melting point | 17 °C |
| Boiling point | 84-86°C 15mm |
| Density | 1.145 |
| refractive index | 1.45 |
| Flash point | 90°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to lump to clear liquid |
| pka | 8.97±0.18(Predicted) |
| color | White or Colorless to Orange to Green |
| BRN | 2098736 |
| InChI | InChI=1S/C7H4F4O/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3,12H |
| InChIKey | DHPCRFYUUWAGAH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 61721-07-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xn |
| Risk Statements | 22-34-36/37/38-20/21/22 |
| Safety Statements | 23-26-28-36/37/39-45 |
| RIDADR | 2922 |
| Hazard Note | Toxic |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29081990 |
