3-(N-Styrylmethyl-2-aminoethylamino)-propyltrimethoxysilane hydrochloride
- Product Name3-(N-Styrylmethyl-2-aminoethylamino)-propyltrimethoxysilane hydrochloride
- CAS34937-00-3
- MFC17H31ClN2O3Si
- MW374.98
- EINECS252-297-3
- MOL File34937-00-3.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 65°C |
| Density | 0.905 g/mL at 25 °C |
| refractive index | n |
| Flash point | 55 °F |
| storage temp. | below 5° C |
| form | powder to crystal |
| color | Light yellow to Brown |
| Specific Gravity | 0.871 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C17H30N2O3Si.ClH/c1-19(14-8-16-23(20-2,21-3)22-4)15-13-18-12-11-17-9-6-5-7-10-17;/h5-7,9-12,18H,8,13-16H2,1-4H3;1H/b12-11+; |
| InChIKey | VNPLAJRFUQRUIS-CALJPSDSSA-N |
| SMILES | [Si](CCCN(C)CCN/C=C/C1=CC=CC=C1)(OC)(OC)OC.[H]Cl |
| EPA Substance Registry System | 1,2-Ethanediamine, N-[(ethenylphenyl)methyl]-N'-[3-(trimethoxysilyl)propyl]-, monohydrochloride (34937-00-3) |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-41-43 |
| Safety Statements | 7-16-23-45 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931900090 |
| HazardClass | 3/6.1 |
| PackingGroup | II |
![N-[2-(N-Vinylbenzylamino)ethyl]-3-aminopropyltrimethoxysilane Hydrochloride pictures](/ProductImageEN/2024-06/Small/14fe6385-2807-4994-89e8-0c5b1513192a.jpg)
