(-)-cis-2-Benzylaminocyclohexanemethanol
- Product Name(-)-cis-2-Benzylaminocyclohexanemethanol
- CAS71581-93-6
- MFC14H21NO
- MW219.32
- EINECS623-138-9
- MOL File71581-93-6.mol
Chemical Properties
| Melting point | 67-69 °C(lit.) |
| Boiling point | 352.8±15.0 °C(Predicted) |
| Density | 1.04±0.1 g/cm3(Predicted) |
| refractive index | -24 ° (C=1, MeOH) |
| storage temp. | 2-8°C, protect from light |
| form | powder to crystal |
| pka | 15.05±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | [α]20/D 24°, c = 1 in methanol |
| BRN | 8393598 |
| InChI | 1S/C14H21NO/c16-11-13-8-4-5-9-14(13)15-10-12-6-2-1-3-7-12/h1-3,6-7,13-16H,4-5,8-11H2/t13-,14-/m1/s1 |
| InChIKey | BRQFIORUNWWNBM-ZIAGYGMSSA-N |
| SMILES | OC[C@H]1CCCC[C@H]1NCc2ccccc2 |
| CAS DataBase Reference | 71581-93-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922.19.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |