cis-3-(Boc-amino)cyclohexanecarboxylic acid
- Product Namecis-3-(Boc-amino)cyclohexanecarboxylic acid
- CAS222530-33-8
- MFC12H21NO4
- MW243.3
- EINECS
- MOL File222530-33-8.mol
Chemical Properties
| Melting point | 143-147℃ |
| Boiling point | 396.7±31.0 °C(Predicted) |
| Density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.62±0.10(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/s3 |
| InChIKey | JSGHMGKJNZTKGF-MASDURLHNA-N |
| SMILES | [C@@H]1(C(O)=O)CCC[C@H](NC(OC(C)(C)C)=O)C1 |&1:0,7,r| |
Safety Information
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |