2-Bromo-5-iodotoluene
- Product Name2-Bromo-5-iodotoluene
- CAS202865-85-8
- MFC7H6BrI
- MW296.93
- EINECS640-232-5
- MOL File202865-85-8.mol
Chemical Properties
| Boiling point | 148°C 20mm |
| Density | 2,07 g/cm3 |
| refractive index | 1.6500 |
| Flash point | 114℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Specific Gravity | 2.07 |
| Sensitive | Light Sensitive |
| BRN | 8760525 |
| InChI | InChI=1S/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | QSQOGKONVJDRNH-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(I)C=C1C |
| CAS DataBase Reference | 202865-85-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 23-36/37/39-45-37-26 |
| RIDADR | 2810 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
