5-Bromo-2-iodotoluene
- Product Name5-Bromo-2-iodotoluene
- CAS116632-39-4
- MFC7H6BrI
- MW296.93
- EINECS629-570-4
- MOL File116632-39-4.mol
Chemical Properties
| Boiling point | 263 °C (lit.) |
| Density | 2.08 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Specific Gravity | 2.08 |
| Sensitive | Light Sensitive |
| BRN | 2325157 |
| InChI | InChI=1S/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| InChIKey | GHTUADBHTFHMNI-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Br)C=C1C |
| CAS DataBase Reference | 116632-39-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |