3-Cyclopentene-1-carboxylic acid
- Product Name3-Cyclopentene-1-carboxylic acid
- CAS7686-77-3
- MFC6H8O2
- MW112.13
- EINECS616-404-0
- MOL File7686-77-3.mol
Chemical Properties
| Boiling point | 215 °C (lit.) |
| Density | 1.084 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 4.62±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.084 |
| InChI | InChI=1S/C6H8O2/c7-6(8)5-3-1-2-4-5/h1-2,5H,3-4H2,(H,7,8) |
| InChIKey | XVSYDLITVYBCBD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CC=CC1 |
| CAS DataBase Reference | 7686-77-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 12 - Non Combustible Liquids |
