2,6-Diaminopimelic acid
- Product Name2,6-Diaminopimelic acid
- CAS583-93-7
- MFC7H14N2O4
- MW190.2
- EINECS209-524-6
- MOL File583-93-7.mol
Chemical Properties
| Melting point | ~295 °C (dec.) (lit.) |
| Boiling point | 325.69°C (rough estimate) |
| Density | 1.2963 (rough estimate) |
| refractive index | 1.4331 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Water (Slightly, Heated) |
| pka | 2.20±0.24(Predicted) |
| form | Powder and/or Chunks |
| color | White to beige |
| Water Solubility | Soluble in water, diluted acids and alkali. |
| BRN | 1787719 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(N)CCCC(N)C(O)=O |
| CAS DataBase Reference | 583-93-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
