| Melting point |
126°C |
| Boiling point |
155-158 °C(Press: 0.03 Torr) |
| Density |
1.222±0.06 g/cm3(Predicted) |
| storage temp. |
Store at room temperature |
| pka |
3.85±0.36(Predicted) |
| form |
powder to crystal |
| color |
White to Orange to Green |
| InChI |
InChI=1S/C14H12O3/c15-14(16)13-9-5-4-6-11(13)10-17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| InChIKey |
YKNORODREYVARM-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC=C1COC1=CC=CC=C1 |
| CAS DataBase Reference |
724-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-(Phenoxymethyl)benzoic acid(724-98-1) |
| EPA Substance Registry System |
Benzoic acid, 2-(phenoxymethyl)- (724-98-1) |
