1,3-Diphenyl-1,1,3,3-tetramethyldisilazane
- Product Name1,3-Diphenyl-1,1,3,3-tetramethyldisilazane
- CAS3449-26-1
- MFC16H23NSi2
- MW285.53
- EINECS222-372-5
- MOL File3449-26-1.mol
Chemical Properties
| Boiling point | 96-100 °C0.1 mm Hg(lit.) |
| Density | 0.985 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 13.75±0.70(Predicted) |
| color | Colorless to Light yellow |
| Specific Gravity | 0.985 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2738118 |
| InChI | InChI=1S/C16H23NSi2/c1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16/h5-14,17H,1-4H3 |
| InChIKey | HIMXYMYMHUAZLW-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C1=CC=CC=C1)N[Si](C)(C)C1=CC=CC=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
