3-Hydroxy-2,4,5-trifluorobenzoic acid
- Product Name3-Hydroxy-2,4,5-trifluorobenzoic acid
- CAS116751-24-7
- MFC7H3F3O3
- MW192.09
- EINECS
- MOL File116751-24-7.mol
Chemical Properties
| Melting point | 143-147 °C(lit.) |
| Boiling point | 292.6±40.0 °C(Predicted) |
| Density | 1.699±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H3F3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13) |
| InChIKey | YYAFUGSJSHXYNK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(O)=C1F |
| CAS DataBase Reference | 116751-24-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
