4-Amino-3-pyridinecarboxylic acid
- Product Name4-Amino-3-pyridinecarboxylic acid
- CAS7418-65-7
- MFC6H6N2O2
- MW138.12
- EINECS628-821-5
- MOL File7418-65-7.mol
Chemical Properties
| Melting point | 307-312 °C |
| Boiling point | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in aqueous acid and base. |
| form | Powder |
| pka | 2.94±0.10(Predicted) |
| color | Cream to yellow |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H6N2O2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | IASBMUIXBJNMDW-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1C(O)=O |
| CAS DataBase Reference | 7418-65-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | N |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |