| Boiling point |
113-115 °C(Press: 4.5 Torr) |
| Density |
0.940±0.06 g/cm3(Predicted) |
| vapor pressure |
9Pa at 25℃ |
| refractive index |
1.54 |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| pka |
4.56±0.10(Predicted) |
| form |
clear liquid |
| color |
Light yellow to Yellow to Orange |
| Water Solubility |
570mg/L at 20℃ |
| InChI |
InChI=1S/C11H17N/c1-4-9-6-8(3)7-10(5-2)11(9)12/h6-7H,4-5,12H2,1-3H3 |
| InChIKey |
OIXUMNZGNCAOKY-UHFFFAOYSA-N |
| SMILES |
C1(N)=C(CC)C=C(C)C=C1CC |
| LogP |
2.294 at 25℃ |
| CAS DataBase Reference |
24544-08-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenamine, 2,6-diethyl-4-methyl- (24544-08-9) |
