Potassium tetrakis(4-chlorophenyl)borate
- Product NamePotassium tetrakis(4-chlorophenyl)borate
- CAS14680-77-4
- MFC24H16BCl4K
- MW496.11
- EINECS238-723-0
- MOL File14680-77-4.mol
Chemical Properties
| Melting point | >300°C |
| solubility | Soluble in chloroform. |
| form | powder to crystaline |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4117827 |
| InChI | 1S/C24H16BCl4.K/c26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20;/h1-16H;/q-1;+1 |
| InChIKey | SAGICZRAKJSWLD-UHFFFAOYSA-N |
| SMILES | [K+].Clc1ccc(cc1)[B-](c2ccc(Cl)cc2)(c3ccc(Cl)cc3)c4ccc(Cl)cc4 |
| CAS DataBase Reference | 14680-77-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |