Potassium tetrakis(4-chlorophenyl)borate
- Product NamePotassium tetrakis(4-chlorophenyl)borate
- CAS14680-77-4
- CBNumberCB7120615
- MFC24H16BCl4K
- MW496.11
- EINECS238-723-0
- MDL NumberMFCD00043105
- MOL File14680-77-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >300°C |
| solubility | Soluble in chloroform. |
| form | powder to crystaline |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4117827 |
| InChI | 1S/C24H16BCl4.K/c26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20;/h1-16H;/q-1;+1 |
| InChIKey | SAGICZRAKJSWLD-UHFFFAOYSA-N |
| SMILES | [K+].Clc1ccc(cc1)[B-](c2ccc(Cl)cc2)(c3ccc(Cl)cc3)c4ccc(Cl)cc4 |
| CAS DataBase Reference | 14680-77-4(CAS DataBase Reference) |
| UNSPSC Code | 26111700 |
| NACRES | NB.61 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P264-P270-P301+P310-P405-P501 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | UN2811 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|