| Melting point |
47-53 °C(lit.) |
| Boiling point |
400.8±28.0 °C(Predicted) |
| Density |
1.115±0.06 g/cm3(Predicted) |
| vapor pressure |
10Pa at 20-50℃ |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| color |
White to Almost white |
| Major Application |
pharmaceutical (small molecule)
pharmaceutical |
| InChI |
InChI=1S/C16H13NO/c1-12(11-17)14-8-5-9-15(10-14)16(18)13-6-3-2-4-7-13/h2-10,12H,1H3 |
| InChIKey |
RGYOCHMZSLUCNP-UHFFFAOYSA-N |
| SMILES |
C1(=CC=CC(C(C)C#N)=C1)C(=O)C1C=CC=CC=1 |
| CAS DataBase Reference |
42872-30-0(CAS DataBase Reference) |
