| Melting point |
69-73 °C(lit.) |
| Boiling point |
337 °C762 mm Hg(lit.) |
| Density |
1.1012 (rough estimate) |
| refractive index |
1.6050 (estimate) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| pka |
-2.73±0.50(Predicted) |
| form |
powder to crystal |
| color |
White to Light yellow to Light orange |
| BRN |
2209397 |
| InChI |
1S/C13H11NO/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H |
| InChIKey |
DCNUQRBLZWSGAV-UHFFFAOYSA-N |
| SMILES |
[H]C(=O)N(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference |
607-00-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Formamide, N,N-diphenyl- (607-00-1) |
