2-Bromo-9-fluorenone
- Product Name2-Bromo-9-fluorenone
- CAS3096-56-8
- MFC13H7BrO
- MW259.1
- EINECS636-546-7
- MOL File3096-56-8.mol
Chemical Properties
| Melting point | 146-148 °C (lit.) |
| Boiling point | 392.8±21.0 °C(Predicted) |
| Density | 1.4633 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in other solvents, soluble in acetone. |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C13H7BrO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H |
| InChIKey | MTCARZDHUIEYMB-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C2=C1C=C(Br)C=C2 |
| CAS DataBase Reference | 3096-56-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
