3-Methylcinnamic acid
- Product Name3-Methylcinnamic acid
- CAS3029-79-6
- MFC10H10O2
- MW162.19
- EINECS221-199-2
- MOL File3029-79-6.mol
Chemical Properties
| Melting point | 116 °C |
| Boiling point | 228.88°C (rough estimate) |
| Density | 1.0281 (rough estimate) |
| refractive index | 1.5766 (estimate) |
| Flash point | >110° |
| storage temp. | Storage temp. 2-8°C |
| pka | 4.44(at 25℃) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2042550 |
| InChI | InChI=1S/C10H10O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | JZINNAKNHHQBOS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=CC(C)=C1 |
| LogP | 2.870 (est) |
| NIST Chemistry Reference | 3-Methylcinnamic acid(3029-79-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36-24/25-22 |
| HS Code | 29163990 |
