Cyclizine Hydrochloride
- Product NameCyclizine Hydrochloride
- CAS303-25-3
- MFC18H23ClN2
- MW302.84162
- EINECS206-136-9
- MOL File303-25-3.mol
Chemical Properties
| Melting point | 258-260℃ |
| Boiling point | 457.04°C (rough estimate) |
| Density | 1.0551 (rough estimate) |
| refractive index | 1.5749 (estimate) |
| storage temp. | Refrigerator |
| solubility | Methanol: 1 mg/ml |
| form | solid |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C18H22N2.ClH/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18H,12-15H2,1H3;1H |
| InChIKey | UKPBEPCQTDRZSE-UHFFFAOYSA-N |
| SMILES | [Cl-].N3(CCN(CC3)C)C(c2ccccc2)c1ccccc1.[H+] |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61-23/24/25-42/43 |
| Safety Statements | 53-22-36/37/39-45 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933595960 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | mouse,LD50,intraperitoneal,58mg/kg (58mg/kg),Pharmacology: International Journal of Experimental and Clinical Pharmacology. Vol. 13, Pg. 241, 1975. |