2',3',4',5',6'-Pentafluoroacetophenone
- Product Name2',3',4',5',6'-Pentafluoroacetophenone
- CAS652-29-9
- MFC8H3F5O
- MW210.1
- EINECS211-487-6
- MOL File652-29-9.mol
Chemical Properties
| Melting point | 130.5 °C |
| Boiling point | 130-131 °C(lit.) |
| Density | 1.476 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 150 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.476 |
| BRN | 2053225 |
| InChI | 1S/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| InChIKey | FBGHCYZBCMDEOX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 652-29-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |