4-(Trifluoromethoxy)phenylacetic acid
- Product Name4-(Trifluoromethoxy)phenylacetic acid
- CAS4315-07-5
- MFC9H7F3O3
- MW220.15
- EINECS624-749-3
- MOL File4315-07-5.mol
Chemical Properties
| Melting point | 85-88 °C(lit.) |
| Boiling point | 260.6±35.0 °C(Predicted) |
| Density | 1.399±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.10±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2695336 |
| InChI | InChI=1S/C9H7F3O3/c10-9(11,12)15-7-3-1-6(2-4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | ZMTIBXQPXBUWPQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 4315-07-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |
